C25H17BrClNO5S — CID 124668189
(5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124668189) has the molecular formula C25H17BrClNO5S and a molecular weight of 558.84 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124668189 |
| Molecular Formula | C25H17BrClNO5S |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 556.97 |
| IUPAC Name | (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(OCc3ccccc3)c(Br)c2)C(=O)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C25H17BrClNO5S/c26-18-8-16(6-7-20(18)31-13-15-4-2-1-3-5-15)9-23-24(29)28(25(30)34-23)12-17-10-21-22(11-19(17)27)33-14-32-21/h1-11H,12-14H2/b23-9+ |
| InChIKey | JPVHRFGJMXFNLG-NUGSKGIGSA-N |
| XLogP | 6.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|