C18H10BrClFNO4S — CID 124668018
(5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124668018) has the molecular formula C18H10BrClFNO4S and a molecular weight of 470.70 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124668018 |
| Molecular Formula | C18H10BrClFNO4S |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 468.92 |
| IUPAC Name | (5E)-5-[(3-bromo-4-fluorophenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(F)c(Br)c2)C(=O)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C18H10BrClFNO4S/c19-11-3-9(1-2-13(11)21)4-16-17(23)22(18(24)27-16)7-10-5-14-15(6-12(10)20)26-8-25-14/h1-6H,7-8H2/b16-4+ |
| InChIKey | SHGXMYLWKDNPSK-AYSLTRBKSA-N |
| XLogP | 5.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|