C25H17Cl2NO5S — CID 124640707
(5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124640707) has the molecular formula C25H17Cl2NO5S and a molecular weight of 514.39 g/mol. Its IUPAC name is (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124640707 |
| Molecular Formula | C25H17Cl2NO5S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(OCc3ccccc3Cl)cc2)C(=O)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C25H17Cl2NO5S/c26-19-4-2-1-3-16(19)13-31-18-7-5-15(6-8-18)9-23-24(29)28(25(30)34-23)12-17-10-21-22(11-20(17)27)33-14-32-21/h1-11H,12-14H2/b23-9+ |
| InChIKey | BIXOKALSJYGDFC-NUGSKGIGSA-N |
| XLogP | 6.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|