C20H14ClNO4S — CID 11840205
(5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-cinnamylidene-1,3-thiazolidine-2,4-dione (PubChem CID 11840205) has the molecular formula C20H14ClNO4S and a molecular weight of 399.86 g/mol. Its IUPAC name is (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-cinnamylidene-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-cinnamylidene-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11840205 |
| Molecular Formula | C20H14ClNO4S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-cinnamylidene-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/C=Cc2ccccc2)C(=O)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C20H14ClNO4S/c21-15-10-17-16(25-12-26-17)9-14(15)11-22-19(23)18(27-20(22)24)8-4-7-13-5-2-1-3-6-13/h1-10H,11-12H2/b7-4?,18-8+ |
| InChIKey | YIHHYXHFMIAISE-FGLYJRMSSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|