C26H19ClN2O6S — CID 73380510
2-[2-[[3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 73380510) has the molecular formula C26H19ClN2O6S and a molecular weight of 522.97 g/mol. Its IUPAC name is 2-[2-[[3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[[3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 73380510 |
| Molecular Formula | C26H19ClN2O6S |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-[2-[[3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccccc1C=C1SC(=O)N(Cc2cc3c(cc2Cl)OCO3)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H19ClN2O6S/c27-19-12-22-21(34-15-35-22)10-17(19)13-29-25(31)23(36-26(29)32)11-16-6-4-5-9-20(16)33-14-24(30)28-18-7-2-1-3-8-18/h1-12H,13-15H2,(H,28,30) |
| InChIKey | PPSYIYVACHVRFS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|