C19H17Cl2NO3S — CID 126218535
(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione (PubChem CID 126218535) has the molecular formula C19H17Cl2NO3S and a molecular weight of 410.32 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126218535 |
| Molecular Formula | C19H17Cl2NO3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCN1C(=O)S/C(=C\c2ccc(-c3cccc(Cl)c3Cl)o2)C1=O |
| InChI | InChI=1S/C19H17Cl2NO3S/c1-2-3-4-10-22-18(23)16(26-19(22)24)11-12-8-9-15(25-12)13-6-5-7-14(20)17(13)21/h5-9,11H,2-4,10H2,1H3/b16-11- |
| InChIKey | OXWNMUIMBNGJGC-WJDWOHSUSA-N |
| XLogP | 6.48 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|