C23H18Cl2N2O2S — CID 6533417
(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 6533417) has the molecular formula C23H18Cl2N2O2S and a molecular weight of 457.38 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6533417 |
| Molecular Formula | C23H18Cl2N2O2S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2ccc(-c3cccc(Cl)c3Cl)o2)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C23H18Cl2N2O2S/c1-2-13-27-22(28)20(30-23(27)26-15-7-4-3-5-8-15)14-16-11-12-19(29-16)17-9-6-10-18(24)21(17)25/h3-12,14H,2,13H2,1H3/b20-14-,26-23+ |
| InChIKey | HCBHZDCRNVRCEB-URWIEHKQSA-N |
| XLogP | 7.27 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|