C24H19ClN2O5S — CID 4046447
2-chloro-4-[5-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 4046447) has the molecular formula C24H19ClN2O5S and a molecular weight of 482.95 g/mol. Its IUPAC name is 2-chloro-4-[5-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4046447 |
| Molecular Formula | C24H19ClN2O5S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-chloro-4-[5-[[3-(2-methoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COCCN1C(=O)C(=Cc2ccc(-c3ccc(C(=O)O)c(Cl)c3)o2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O5S/c1-31-12-11-27-22(28)21(33-24(27)26-16-5-3-2-4-6-16)14-17-8-10-20(32-17)15-7-9-18(23(29)30)19(25)13-15/h2-10,13-14H,11-12H2,1H3,(H,29,30)/b21-14?,26-24- |
| InChIKey | BKEMRAJZDHCJFJ-YQECMLSGSA-N |
| XLogP | 5.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|