C25H21ClN2O6S — CID 42626085
2-chloro-5-[5-[(E)-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 42626085) has the molecular formula C25H21ClN2O6S and a molecular weight of 512.97 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(E)-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 42626085 |
| Molecular Formula | C25H21ClN2O6S |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 2-chloro-5-[5-[(E)-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COCCN1C(=O)/C(=C\c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H21ClN2O6S/c1-32-12-11-28-23(29)22(35-25(28)27-16-4-6-17(33-2)7-5-16)14-18-8-10-21(34-18)15-3-9-20(26)19(13-15)24(30)31/h3-10,13-14H,11-12H2,1-2H3,(H,30,31)/b22-14+,27-25- |
| InChIKey | OJAZWPDUKBLLDV-LEMJEDKYSA-N |
| XLogP | 5.56 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|