C18H15NO6S — CID 126130704
4-[5-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126130704) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-[5-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126130704 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-[5-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COCCN1C(=O)S/C(=C/c2ccc(-c3ccc(C(=O)O)cc3)o2)C1=O |
| InChI | InChI=1S/C18H15NO6S/c1-24-9-8-19-16(20)15(26-18(19)23)10-13-6-7-14(25-13)11-2-4-12(5-3-11)17(21)22/h2-7,10H,8-9H2,1H3,(H,21,22)/b15-10+ |
| InChIKey | HEAKDIXPGLXDHN-XNTDXEJSSA-N |
| XLogP | 3.33 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|