C24H19NO4S2 — CID 135187285
4-[5-[[3-[(3,4-dimethylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 135187285) has the molecular formula C24H19NO4S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[5-[[3-[(3,4-dimethylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[[3-[(3,4-dimethylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 135187285 |
| Molecular Formula | C24H19NO4S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 4-[5-[[3-[(3,4-dimethylphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | Cc1ccc(CN2C(=O)C(=Cc3ccc(-c4ccc(C(=O)O)cc4)o3)SC2=S)cc1C |
| InChI | InChI=1S/C24H19NO4S2/c1-14-3-4-16(11-15(14)2)13-25-22(26)21(31-24(25)30)12-19-9-10-20(29-19)17-5-7-18(8-6-17)23(27)28/h3-12H,13H2,1-2H3,(H,27,28) |
| InChIKey | XEMIVELOSGTHSW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|