C22H14ClNO5S2 — CID 91799340
4-[5-[(Z)-[3-[(4-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid (PubChem CID 91799340) has the molecular formula C22H14ClNO5S2 and a molecular weight of 471.94 g/mol. Its IUPAC name is 4-[5-[(Z)-[3-[(4-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[5-[(Z)-[3-[(4-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 91799340 |
| Molecular Formula | C22H14ClNO5S2 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | 4-[5-[(Z)-[3-[(4-chlorophenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=C3\SC(=S)N(Cc4ccc(Cl)cc4)C3=O)o2)cc1O |
| InChI | InChI=1S/C22H14ClNO5S2/c23-14-4-1-12(2-5-14)11-24-20(26)19(31-22(24)30)10-15-6-8-18(29-15)13-3-7-16(21(27)28)17(25)9-13/h1-10,25H,11H2,(H,27,28)/b19-10- |
| InChIKey | KFVPVTYVDJMFKG-GRSHGNNSSA-N |
| XLogP | 5.41 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|