C25H21NO5S2 — CID 146001011
4-[5-[(Z)-[3-[2-(4-ethylphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid (PubChem CID 146001011) has the molecular formula C25H21NO5S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-[5-[(Z)-[3-[2-(4-ethylphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[5-[(Z)-[3-[2-(4-ethylphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 146001011 |
| Molecular Formula | C25H21NO5S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 4-[5-[(Z)-[3-[2-(4-ethylphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-hydroxybenzoic acid |
| SMILES | CCc1ccc(CCN2C(=O)/C(=C/c3ccc(-c4ccc(C(=O)O)c(O)c4)o3)SC2=S)cc1 |
| InChI | InChI=1S/C25H21NO5S2/c1-2-15-3-5-16(6-4-15)11-12-26-23(28)22(33-25(26)32)14-18-8-10-21(31-18)17-7-9-19(24(29)30)20(27)13-17/h3-10,13-14,27H,2,11-12H2,1H3,(H,29,30)/b22-14- |
| InChIKey | SVYIIAVXHMJQHE-HMAPJEAMSA-N |
| XLogP | 5.36 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|