C29H33N3O2S2 — CID 176664837
ethane;(5Z)-5-[[5-[4-(4-methylpiperazin-1-yl)phenyl]furan-2-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 176664837) has the molecular formula C29H33N3O2S2 and a molecular weight of 519.74 g/mol. Its IUPAC name is ethane;(5Z)-5-[[5-[4-(4-methylpiperazin-1-yl)phenyl]furan-2-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | ethane;(5Z)-5-[[5-[4-(4-methylpiperazin-1-yl)phenyl]furan-2-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 176664837 |
| Molecular Formula | C29H33N3O2S2 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | ethane;(5Z)-5-[[5-[4-(4-methylpiperazin-1-yl)phenyl]furan-2-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC.CN1CCN(c2ccc(-c3ccc(/C=C4\SC(=S)N(CCc5ccccc5)C4=O)o3)cc2)CC1 |
| InChI | InChI=1S/C27H27N3O2S2.C2H6/c1-28-15-17-29(18-16-28)22-9-7-21(8-10-22)24-12-11-23(32-24)19-25-26(31)30(27(33)34-25)14-13-20-5-3-2-4-6-20;1-2/h2-12,19H,13-18H2,1H3;1-2H3/b25-19-; |
| InChIKey | ZKDDFOCXGWZKBQ-VQFXXQHUSA-N |
| XLogP | 6.17 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|