C21H10Cl3NO4S2 — CID 126357691
2-chloro-4-[5-[(E)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126357691) has the molecular formula C21H10Cl3NO4S2 and a molecular weight of 510.81 g/mol. Its IUPAC name is 2-chloro-4-[5-[(E)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[(E)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126357691 |
| Molecular Formula | C21H10Cl3NO4S2 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 508.91 |
| IUPAC Name | 2-chloro-4-[5-[(E)-[3-(2,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=C3/SC(=S)N(c4ccc(Cl)cc4Cl)C3=O)o2)cc1Cl |
| InChI | InChI=1S/C21H10Cl3NO4S2/c22-11-2-5-16(15(24)8-11)25-19(26)18(31-21(25)30)9-12-3-6-17(29-12)10-1-4-13(20(27)28)14(23)7-10/h1-9H,(H,27,28)/b18-9+ |
| InChIKey | VNSBMKRCBBLOLJ-GIJQJNRQSA-N |
| XLogP | 7.01 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|