C22H12ClNO6S2 — CID 126339786
5-[5-[(Z)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 126339786) has the molecular formula C22H12ClNO6S2 and a molecular weight of 485.93 g/mol. Its IUPAC name is 5-[5-[(Z)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[(Z)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 126339786 |
| Molecular Formula | C22H12ClNO6S2 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | 5-[5-[(Z)-[3-(3-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccc(/C=C3\SC(=S)N(c4cccc(Cl)c4)C3=O)o2)c1 |
| InChI | InChI=1S/C22H12ClNO6S2/c23-14-2-1-3-15(9-14)24-19(25)18(32-22(24)31)10-16-4-5-17(30-16)11-6-12(20(26)27)8-13(7-11)21(28)29/h1-10H,(H,26,27)(H,28,29)/b18-10- |
| InChIKey | UWVCWNJFBVDZQT-ZDLGFXPLSA-N |
| XLogP | 5.40 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|