C22H14ClNO5S — CID 126205735
4-[5-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoic acid (PubChem CID 126205735) has the molecular formula C22H14ClNO5S and a molecular weight of 439.88 g/mol. Its IUPAC name is 4-[5-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 126205735 |
| Molecular Formula | C22H14ClNO5S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 4-[5-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C22H14ClNO5S/c1-12-9-13(21(26)27)5-7-17(12)18-8-6-16(29-18)11-19-20(25)24(22(28)30-19)15-4-2-3-14(23)10-15/h2-11H,1H3,(H,26,27)/b19-11+ |
| InChIKey | DFWNHOLISFTTCU-YBFXNURJSA-N |
| XLogP | 5.85 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|