C23H17NO4S3 — CID 18773065
3-methyl-4-[5-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 18773065) has the molecular formula C23H17NO4S3 and a molecular weight of 467.59 g/mol. Its IUPAC name is 3-methyl-4-[5-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-methyl-4-[5-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18773065 |
| Molecular Formula | C23H17NO4S3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 3-methyl-4-[5-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CSc1cccc(N2C(=O)/C(=C\c3ccc(-c4ccc(C(=O)O)cc4C)o3)SC2=S)c1 |
| InChI | InChI=1S/C23H17NO4S3/c1-13-10-14(22(26)27)6-8-18(13)19-9-7-16(28-19)12-20-21(25)24(23(29)31-20)15-4-3-5-17(11-15)30-2/h3-12H,1-2H3,(H,26,27)/b20-12+ |
| InChIKey | HZSVFPLDUSNIEZ-UDWIEESQSA-N |
| XLogP | 6.08 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|