C24H17NO6S2 — CID 126345678
5-[5-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 126345678) has the molecular formula C24H17NO6S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 5-[5-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 126345678 |
| Molecular Formula | C24H17NO6S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 5-[5-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc(-c4cc(C(=O)O)cc(C(=O)O)c4)o3)SC2=S)cc1C |
| InChI | InChI=1S/C24H17NO6S2/c1-12-3-4-17(7-13(12)2)25-21(26)20(33-24(25)32)11-18-5-6-19(31-18)14-8-15(22(27)28)10-16(9-14)23(29)30/h3-11H,1-2H3,(H,27,28)(H,29,30)/b20-11+ |
| InChIKey | VXQPUJQFGPVVKR-RGVLZGJSSA-N |
| XLogP | 5.37 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|