C21H11Cl2NO4S2 — CID 6534495
4-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 6534495) has the molecular formula C21H11Cl2NO4S2 and a molecular weight of 476.36 g/mol. Its IUPAC name is 4-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 6534495 |
| Molecular Formula | C21H11Cl2NO4S2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | 4-[(5Z)-5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)/C(=C/c3ccc(-c4cccc(Cl)c4Cl)o3)SC2=S)cc1 |
| InChI | InChI=1S/C21H11Cl2NO4S2/c22-15-3-1-2-14(18(15)23)16-9-8-13(28-16)10-17-19(25)24(21(29)30-17)12-6-4-11(5-7-12)20(26)27/h1-10H,(H,26,27)/b17-10- |
| InChIKey | DEVORSCVJQRCPL-YVLHZVERSA-N |
| XLogP | 6.36 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|