C21H10ClF3N2O4S2 — CID 508124
4-[5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 508124) has the molecular formula C21H10ClF3N2O4S2 and a molecular weight of 510.90 g/mol. Its IUPAC name is 4-[5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 508124 |
| Molecular Formula | C21H10ClF3N2O4S2 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 4-[5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)C(=Cc3ccc(-c4ncc(C(F)(F)F)cc4Cl)o3)SC2=S)cc1 |
| InChI | InChI=1S/C21H10ClF3N2O4S2/c22-14-7-11(21(23,24)25)9-26-17(14)15-6-5-13(31-15)8-16-18(28)27(20(32)33-16)12-3-1-10(2-4-12)19(29)30/h1-9H,(H,29,30) |
| InChIKey | YQNBKPVAOYRVOQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|