C20H16ClF3N2O4S2 — CID 58644755
6-[(5Z)-5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 58644755) has the molecular formula C20H16ClF3N2O4S2 and a molecular weight of 504.94 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 58644755 |
| Molecular Formula | C20H16ClF3N2O4S2 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 6-[(5Z)-5-[[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2ccc(-c3ncc(C(F)(F)F)cc3Cl)o2)SC1=S |
| InChI | InChI=1S/C20H16ClF3N2O4S2/c21-13-8-11(20(22,23)24)10-25-17(13)14-6-5-12(30-14)9-15-18(29)26(19(31)32-15)7-3-1-2-4-16(27)28/h5-6,8-10H,1-4,7H2,(H,27,28)/b15-9- |
| InChIKey | OQCZXYMZJUNDDH-DHDCSXOGSA-N |
| XLogP | 5.86 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|