C20H10Cl2N2O5S — CID 50871047
(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 50871047) has the molecular formula C20H10Cl2N2O5S and a molecular weight of 461.28 g/mol. Its IUPAC name is (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50871047 |
| Molecular Formula | C20H10Cl2N2O5S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H10Cl2N2O5S/c21-11-2-1-3-12(8-11)23-19(25)18(30-20(23)26)10-14-5-7-17(29-14)15-9-13(24(27)28)4-6-16(15)22/h1-10H/b18-10+ |
| InChIKey | MSKAOOMHNAZUDZ-VCHYOVAHSA-N |
| XLogP | 6.40 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|