C20H11ClN2O5S — CID 50871007
(5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 50871007) has the molecular formula C20H11ClN2O5S and a molecular weight of 426.84 g/mol. Its IUPAC name is (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50871007 |
| Molecular Formula | C20H11ClN2O5S |
| Molecular Weight | 426.84 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (5E)-5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H11ClN2O5S/c21-16-8-6-13(23(26)27)10-15(16)17-9-7-14(28-17)11-18-19(24)22(20(25)29-18)12-4-2-1-3-5-12/h1-11H/b18-11+ |
| InChIKey | OWNWJJZDAWGNSU-WOJGMQOQSA-N |
| XLogP | 5.75 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|