C27H16ClN3O5S — CID 1102772
5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1102772) has the molecular formula C27H16ClN3O5S and a molecular weight of 529.96 g/mol. Its IUPAC name is 5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1102772 |
| Molecular Formula | C27H16ClN3O5S |
| Molecular Weight | 529.96 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 5-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1C(=Cc2ccc(-c3cc([N+](=O)[O-])ccc3Cl)o2)C(=O)N(c2ccccc2)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C27H16ClN3O5S/c28-23-13-11-19(31(34)35)15-21(23)24-14-12-20(36-24)16-22-25(32)29(17-7-3-1-4-8-17)27(37)30(26(22)33)18-9-5-2-6-10-18/h1-16H |
| InChIKey | LDSDJBLIILURFC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.96 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|