C20H11BrClNO3S — CID 126216204
(5E)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126216204) has the molecular formula C20H11BrClNO3S and a molecular weight of 460.74 g/mol. Its IUPAC name is (5E)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126216204 |
| Molecular Formula | C20H11BrClNO3S |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | (5E)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3cccc(Br)c3)o2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H11BrClNO3S/c21-13-4-1-3-12(9-13)17-8-7-16(26-17)11-18-19(24)23(20(25)27-18)15-6-2-5-14(22)10-15/h1-11H/b18-11+ |
| InChIKey | KFOFQLKOQIGTBC-WOJGMQOQSA-N |
| XLogP | 6.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|