C21H13Cl2NO3S — CID 18809409
(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18809409) has the molecular formula C21H13Cl2NO3S and a molecular weight of 430.31 g/mol. Its IUPAC name is (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18809409 |
| Molecular Formula | C21H13Cl2NO3S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-(4-methylphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)S/C(=C\c3ccc(-c4ccc(Cl)c(Cl)c4)o3)C2=O)cc1 |
| InChI | InChI=1S/C21H13Cl2NO3S/c1-12-2-5-14(6-3-12)24-20(25)19(28-21(24)26)11-15-7-9-18(27-15)13-4-8-16(22)17(23)10-13/h2-11H,1H3/b19-11- |
| InChIKey | AJLDADXEHSIQFQ-ODLFYWEKSA-N |
| XLogP | 6.80 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|