C23H17ClN2O4S2 — CID 126178885
2-chloro-5-[5-[(E)-[3-methyl-2-(3-methylsulfanylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126178885) has the molecular formula C23H17ClN2O4S2 and a molecular weight of 484.99 g/mol. Its IUPAC name is 2-chloro-5-[5-[(E)-[3-methyl-2-(3-methylsulfanylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(E)-[3-methyl-2-(3-methylsulfanylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126178885 |
| Molecular Formula | C23H17ClN2O4S2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 2-chloro-5-[5-[(E)-[3-methyl-2-(3-methylsulfanylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CSc1cccc(/N=C2\S/C(=C/c3ccc(-c4ccc(Cl)c(C(=O)O)c4)o3)C(=O)N2C)c1 |
| InChI | InChI=1S/C23H17ClN2O4S2/c1-26-21(27)20(32-23(26)25-14-4-3-5-16(11-14)31-2)12-15-7-9-19(30-15)13-6-8-18(24)17(10-13)22(28)29/h3-12H,1-2H3,(H,28,29)/b20-12+,25-23- |
| InChIKey | DLGBERBESZJSIZ-GYOQDEGTSA-N |
| XLogP | 6.25 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|