C21H21ClN2O4S — CID 126205575
2-chloro-5-[5-[(Z)-(4-oxo-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 126205575) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-(4-oxo-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(Z)-(4-oxo-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126205575 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-(4-oxo-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | CC(C)/N=C1\S/C(=C\c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)C(=O)N1C(C)C |
| InChI | InChI=1S/C21H21ClN2O4S/c1-11(2)23-21-24(12(3)4)19(25)18(29-21)10-14-6-8-17(28-14)13-5-7-16(22)15(9-13)20(26)27/h5-12H,1-4H3,(H,26,27)/b18-10-,23-21- |
| InChIKey | BRUBILYGTJZEQJ-MBCVIIHWSA-N |
| XLogP | 5.39 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|