C20H20Cl2N2O2S — CID 126221644
(5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126221644) has the molecular formula C20H20Cl2N2O2S and a molecular weight of 423.37 g/mol. Its IUPAC name is (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126221644 |
| Molecular Formula | C20H20Cl2N2O2S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (5Z)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)/N=C1\S/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)C(=O)N1C(C)C |
| InChI | InChI=1S/C20H20Cl2N2O2S/c1-11(2)23-20-24(12(3)4)19(25)18(27-20)10-14-6-8-17(26-14)13-5-7-15(21)16(22)9-13/h5-12H,1-4H3/b18-10-,23-20- |
| InChIKey | YVBISTUPMLKETD-ZGNGNRKCSA-N |
| XLogP | 6.34 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|