C18H16Cl2N2O2S — CID 4515459
5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one (PubChem CID 4515459) has the molecular formula C18H16Cl2N2O2S and a molecular weight of 395.31 g/mol. Its IUPAC name is 5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4515459 |
| Molecular Formula | C18H16Cl2N2O2S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-ethyl-2-ethylimino-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1/SC(=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)C(=O)N1CC |
| InChI | InChI=1S/C18H16Cl2N2O2S/c1-3-21-18-22(4-2)17(23)16(25-18)10-12-6-8-15(24-12)11-5-7-13(19)14(20)9-11/h5-10H,3-4H2,1-2H3/b16-10?,21-18+ |
| InChIKey | OUGIOUYMMITYEF-OFESAXTESA-N |
| XLogP | 5.57 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|