C14H16Br2N2O2S — CID 126214462
(5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126214462) has the molecular formula C14H16Br2N2O2S and a molecular weight of 436.17 g/mol. Its IUPAC name is (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126214462 |
| Molecular Formula | C14H16Br2N2O2S |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 433.93 |
| IUPAC Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)/N=C1\S/C(=C/c2cc(Br)c(Br)o2)C(=O)N1C(C)C |
| InChI | InChI=1S/C14H16Br2N2O2S/c1-7(2)17-14-18(8(3)4)13(19)11(21-14)6-9-5-10(15)12(16)20-9/h5-8H,1-4H3/b11-6+,17-14- |
| InChIKey | BKBQFZHDSNXMQR-NCZFNZNSSA-N |
| XLogP | 4.89 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|