C18H23BrN2O3S — CID 126217895
(5E)-5-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126217895) has the molecular formula C18H23BrN2O3S and a molecular weight of 427.36 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126217895 |
| Molecular Formula | C18H23BrN2O3S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (5E)-5-[(5-bromo-2,3-dimethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(Br)cc(/C=C2/S/C(=N\C(C)C)N(C(C)C)C2=O)c1OC |
| InChI | InChI=1S/C18H23BrN2O3S/c1-10(2)20-18-21(11(3)4)17(22)15(25-18)8-12-7-13(19)9-14(23-5)16(12)24-6/h7-11H,1-6H3/b15-8+,20-18- |
| InChIKey | OBCYYVQFLQLTRC-JUDSMDKYSA-N |
| XLogP | 4.56 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|