C17H22N2O2S — CID 126217318
(5E)-5-[(4-methoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126217318) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (5E)-5-[(4-methoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126217318 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2/S/C(=N\C(C)C)N(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-11(2)18-17-19(12(3)4)16(20)15(22-17)10-13-6-8-14(21-5)9-7-13/h6-12H,1-5H3/b15-10+,18-17- |
| InChIKey | HUKBHLGEVMLWAB-RUCSPORFSA-N |
| XLogP | 3.78 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|