C23H24Cl2N2O2S — CID 126217415
(5E)-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126217415) has the molecular formula C23H24Cl2N2O2S and a molecular weight of 463.43 g/mol. Its IUPAC name is (5E)-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126217415 |
| Molecular Formula | C23H24Cl2N2O2S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (5E)-5-[(3,5-dichloro-4-phenylmethoxyphenyl)methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)/N=C1\S/C(=C/c2cc(Cl)c(OCc3ccccc3)c(Cl)c2)C(=O)N1C(C)C |
| InChI | InChI=1S/C23H24Cl2N2O2S/c1-14(2)26-23-27(15(3)4)22(28)20(30-23)12-17-10-18(24)21(19(25)11-17)29-13-16-8-6-5-7-9-16/h5-12,14-15H,13H2,1-4H3/b20-12+,26-23- |
| InChIKey | NBUSIPAFSKBTNN-BYVRFLJOSA-N |
| XLogP | 6.66 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|