C23H25FN2O2S — CID 126217784
(5E)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126217784) has the molecular formula C23H25FN2O2S and a molecular weight of 412.53 g/mol. Its IUPAC name is (5E)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126217784 |
| Molecular Formula | C23H25FN2O2S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (5E)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CC(C)/N=C1\S/C(=C/c2ccc(OCc3ccccc3F)cc2)C(=O)N1C(C)C |
| InChI | InChI=1S/C23H25FN2O2S/c1-15(2)25-23-26(16(3)4)22(27)21(29-23)13-17-9-11-19(12-10-17)28-14-18-7-5-6-8-20(18)24/h5-13,15-16H,14H2,1-4H3/b21-13+,25-23- |
| InChIKey | OHHHAPAKFPMAAH-RRJMXWIWSA-N |
| XLogP | 5.49 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|