C20H24Br2N2O2S — CID 6144921
(5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(4,5-dibromofuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 6144921) has the molecular formula C20H24Br2N2O2S and a molecular weight of 516.30 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(4,5-dibromofuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(4,5-dibromofuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6144921 |
| Molecular Formula | C20H24Br2N2O2S |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(4,5-dibromofuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(Br)o2)S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C20H24Br2N2O2S/c21-16-11-15(26-18(16)22)12-17-19(25)24(14-9-5-2-6-10-14)20(27-17)23-13-7-3-1-4-8-13/h11-14H,1-10H2/b17-12-,23-20- |
| InChIKey | QRSVMKQDJUOZPQ-NSMLSGJHSA-N |
| XLogP | 6.74 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|