C26H30BrN3OS — CID 3849315
5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one (PubChem CID 3849315) has the molecular formula C26H30BrN3OS and a molecular weight of 512.52 g/mol. Its IUPAC name is 5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3849315 |
| Molecular Formula | C26H30BrN3OS |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccn2-c2cccc(Br)c2)S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C26H30BrN3OS/c27-19-9-7-14-22(17-19)29-16-8-15-23(29)18-24-25(31)30(21-12-5-2-6-13-21)26(32-24)28-20-10-3-1-4-11-20/h7-9,14-18,20-21H,1-6,10-13H2/b24-18?,28-26- |
| InChIKey | APDQMSQFRIZFBE-KWBJKBDRSA-N |
| XLogP | 7.18 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|