C26H31N3OS — CID 4693551
3-cyclohexyl-2-cyclohexylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 4693551) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4693551 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[(1-phenylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccn2-c2ccccc2)S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C26H31N3OS/c30-25-24(19-23-17-10-18-28(23)21-13-6-2-7-14-21)31-26(27-20-11-4-1-5-12-20)29(25)22-15-8-3-9-16-22/h2,6-7,10,13-14,17-20,22H,1,3-5,8-9,11-12,15-16H2/b24-19?,27-26- |
| InChIKey | WICUPHOWZZISEL-PQBKLRKCSA-N |
| XLogP | 6.41 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|