C28H35N3OS — CID 3447540
3-cyclohexyl-2-cyclohexylimino-5-[[1-(2,3-dimethylphenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 3447540) has the molecular formula C28H35N3OS and a molecular weight of 461.68 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[[1-(2,3-dimethylphenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[[1-(2,3-dimethylphenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3447540 |
| Molecular Formula | C28H35N3OS |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[[1-(2,3-dimethylphenyl)pyrrol-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(-n2cccc2C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c1C |
| InChI | InChI=1S/C28H35N3OS/c1-20-11-9-17-25(21(20)2)30-18-10-16-24(30)19-26-27(32)31(23-14-7-4-8-15-23)28(33-26)29-22-12-5-3-6-13-22/h9-11,16-19,22-23H,3-8,12-15H2,1-2H3/b26-19?,29-28- |
| InChIKey | PICWGSNZCZPXTK-JAIZLMPASA-N |
| XLogP | 7.03 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|