C28H34IN3OS — CID 4273627
3-cyclohexyl-2-cyclohexylimino-5-[[1-(3-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 4273627) has the molecular formula C28H34IN3OS and a molecular weight of 587.57 g/mol. Its IUPAC name is 3-cyclohexyl-2-cyclohexylimino-5-[[1-(3-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-cyclohexylimino-5-[[1-(3-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4273627 |
| Molecular Formula | C28H34IN3OS |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 3-cyclohexyl-2-cyclohexylimino-5-[[1-(3-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)c(C)n1-c1cccc(I)c1 |
| InChI | InChI=1S/C28H34IN3OS/c1-19-16-21(20(2)31(19)25-15-9-10-22(29)18-25)17-26-27(33)32(24-13-7-4-8-14-24)28(34-26)30-23-11-5-3-6-12-23/h9-10,15-18,23-24H,3-8,11-14H2,1-2H3/b26-17?,30-28- |
| InChIKey | USFRTGRZZXCRNX-JHEMAPFISA-N |
| XLogP | 7.64 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|