C27H37N3O2S — CID 126114379
(5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(2-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126114379) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(2-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(2-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126114379 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (5Z)-3-cyclohexyl-2-cyclohexylimino-5-[(2-methyl-4-morpholin-4-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(N2CCOCC2)ccc1/C=C1\S/C(=N\C2CCCCC2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C27H37N3O2S/c1-20-18-24(29-14-16-32-17-15-29)13-12-21(20)19-25-26(31)30(23-10-6-3-7-11-23)27(33-25)28-22-8-4-2-5-9-22/h12-13,18-19,22-23H,2-11,14-17H2,1H3/b25-19-,28-27- |
| InChIKey | RQEMLCGKXNQSJK-NKDOTSDESA-N |
| XLogP | 5.77 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|