C26H35N3O3 — CID 59297359
(5E)-3-cyclohexyl-2-cyclohexylimino-5-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazolidin-4-one (PubChem CID 59297359) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 59297359 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (5E)-3-cyclohexyl-2-cyclohexylimino-5-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(N3CCOCC3)cc2)O/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C26H35N3O3/c30-25-24(19-20-11-13-22(14-12-20)28-15-17-31-18-16-28)32-26(27-21-7-3-1-4-8-21)29(25)23-9-5-2-6-10-23/h11-14,19,21,23H,1-10,15-18H2/b24-19+,27-26- |
| InChIKey | WYMMVTXREQAKOJ-GJHWIIEUSA-N |
| XLogP | 4.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|