C28H32N2O3 — CID 4536428
2,6-bis[(4-morpholin-4-ylphenyl)methylidene]cyclohexan-1-one (PubChem CID 4536428) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2,6-bis[(4-morpholin-4-ylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | 2,6-bis[(4-morpholin-4-ylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 4536428 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2,6-bis[(4-morpholin-4-ylphenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1C(=Cc2ccc(N3CCOCC3)cc2)CCCC1=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H32N2O3/c31-28-24(20-22-4-8-26(9-5-22)29-12-16-32-17-13-29)2-1-3-25(28)21-23-6-10-27(11-7-23)30-14-18-33-19-15-30/h4-11,20-21H,1-3,12-19H2 |
| InChIKey | XFUXWMFNOXVYNL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|