C36H48N2O5 — CID 71518857
(2E,6E)-2,6-bis[[4-(4-morpholin-4-ylbutoxy)phenyl]methylidene]cyclohexan-1-one (PubChem CID 71518857) has the molecular formula C36H48N2O5 and a molecular weight of 588.79 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[[4-(4-morpholin-4-ylbutoxy)phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[[4-(4-morpholin-4-ylbutoxy)phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 71518857 |
| Molecular Formula | C36H48N2O5 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | (2E,6E)-2,6-bis[[4-(4-morpholin-4-ylbutoxy)phenyl]methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccc(OCCCCN3CCOCC3)cc2)CCC/C1=C\c1ccc(OCCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C36H48N2O5/c39-36-32(28-30-8-12-34(13-9-30)42-22-3-1-16-37-18-24-40-25-19-37)6-5-7-33(36)29-31-10-14-35(15-11-31)43-23-4-2-17-38-20-26-41-27-21-38/h8-15,28-29H,1-7,16-27H2/b32-28+,33-29+ |
| InChIKey | UBSFAVKXLJBOBS-NUOLXNBNSA-N |
| XLogP | 5.89 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|