C30H37N3O3 — CID 5018916
3,5-bis[(4-morpholin-4-ylphenyl)methylidene]-1-propan-2-ylpiperidin-4-one (PubChem CID 5018916) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is 3,5-bis[(4-morpholin-4-ylphenyl)methylidene]-1-propan-2-ylpiperidin-4-one.
| Compound Name | 3,5-bis[(4-morpholin-4-ylphenyl)methylidene]-1-propan-2-ylpiperidin-4-one |
|---|---|
| PubChem CID | 5018916 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 3,5-bis[(4-morpholin-4-ylphenyl)methylidene]-1-propan-2-ylpiperidin-4-one |
| SMILES | CC(C)N1CC(=Cc2ccc(N3CCOCC3)cc2)C(=O)C(=Cc2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C30H37N3O3/c1-23(2)33-21-26(19-24-3-7-28(8-4-24)31-11-15-35-16-12-31)30(34)27(22-33)20-25-5-9-29(10-6-25)32-13-17-36-18-14-32/h3-10,19-20,23H,11-18,21-22H2,1-2H3 |
| InChIKey | VTQOPFDARXUZBB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|