C22H21F2NO — CID 7007670
(3Z)-3,5-bis[(4-fluorophenyl)methylidene]-1-propan-2-ylpiperidin-4-one (PubChem CID 7007670) has the molecular formula C22H21F2NO and a molecular weight of 353.41 g/mol. Its IUPAC name is (3Z)-3,5-bis[(4-fluorophenyl)methylidene]-1-propan-2-ylpiperidin-4-one.
| Compound Name | (3Z)-3,5-bis[(4-fluorophenyl)methylidene]-1-propan-2-ylpiperidin-4-one |
|---|---|
| PubChem CID | 7007670 |
| Molecular Formula | C22H21F2NO |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (3Z)-3,5-bis[(4-fluorophenyl)methylidene]-1-propan-2-ylpiperidin-4-one |
| SMILES | CC(C)N1CC(=Cc2ccc(F)cc2)C(=O)/C(=C\c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H21F2NO/c1-15(2)25-13-18(11-16-3-7-20(23)8-4-16)22(26)19(14-25)12-17-5-9-21(24)10-6-17/h3-12,15H,13-14H2,1-2H3/b18-11-,19-12? |
| InChIKey | RRHSEVXTBDLMRI-RSLCLNNDSA-N |
| XLogP | 4.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|