C19H17FN2O — CID 169098271
(3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one (PubChem CID 169098271) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one.
| Compound Name | (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 169098271 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3E,5E)-3-[(4-fluorophenyl)methylidene]-1-methyl-5-(pyridin-3-ylmethylidene)piperidin-4-one |
| SMILES | CN1C/C(=C\c2ccc(F)cc2)C(=O)/C(=C/c2cccnc2)C1 |
| InChI | InChI=1S/C19H17FN2O/c1-22-12-16(9-14-4-6-18(20)7-5-14)19(23)17(13-22)10-15-3-2-8-21-11-15/h2-11H,12-13H2,1H3/b16-9+,17-10+ |
| InChIKey | YXGGXUJGFSAPGM-CZCYGEDCSA-N |
| XLogP | 3.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|