C25H20F2N2O — CID 47086971
(3Z,5E)-3,5-bis[(4-fluorophenyl)methylidene]-1-(pyridin-3-ylmethyl)piperidin-4-one (PubChem CID 47086971) has the molecular formula C25H20F2N2O and a molecular weight of 402.44 g/mol. Its IUPAC name is (3Z,5E)-3,5-bis[(4-fluorophenyl)methylidene]-1-(pyridin-3-ylmethyl)piperidin-4-one.
| Compound Name | (3Z,5E)-3,5-bis[(4-fluorophenyl)methylidene]-1-(pyridin-3-ylmethyl)piperidin-4-one |
|---|---|
| PubChem CID | 47086971 |
| Molecular Formula | C25H20F2N2O |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (3Z,5E)-3,5-bis[(4-fluorophenyl)methylidene]-1-(pyridin-3-ylmethyl)piperidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(F)cc2)CN(Cc2cccnc2)C/C1=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20F2N2O/c26-23-7-3-18(4-8-23)12-21-16-29(15-20-2-1-11-28-14-20)17-22(25(21)30)13-19-5-9-24(27)10-6-19/h1-14H,15-17H2/b21-12-,22-13+ |
| InChIKey | YMFFSJWSBVHAKU-VZHHCOETSA-N |
| XLogP | 4.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|