C30H29N3O3 — CID 76860121
4-[[1-benzyl-5-[[4-(methylcarbamoyl)phenyl]methylidene]-4-oxopiperidin-3-ylidene]methyl]-N-methylbenzamide (PubChem CID 76860121) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-[[1-benzyl-5-[[4-(methylcarbamoyl)phenyl]methylidene]-4-oxopiperidin-3-ylidene]methyl]-N-methylbenzamide.
| Compound Name | 4-[[1-benzyl-5-[[4-(methylcarbamoyl)phenyl]methylidene]-4-oxopiperidin-3-ylidene]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 76860121 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-[[1-benzyl-5-[[4-(methylcarbamoyl)phenyl]methylidene]-4-oxopiperidin-3-ylidene]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(C=C2CN(Cc3ccccc3)CC(=Cc3ccc(C(=O)NC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O3/c1-31-29(35)24-12-8-21(9-13-24)16-26-19-33(18-23-6-4-3-5-7-23)20-27(28(26)34)17-22-10-14-25(15-11-22)30(36)32-2/h3-17H,18-20H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | JYRJUTLVFOKIGN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|